@charset "UTF-8";

/* =========================================================
   TOP page
   Common widths / gutters / colors are inherited from base.css.
========================================================= */

.top-page {
  overflow: hidden;
  padding-bottom: 0;
  background: var(--color-gray0);
}

.top-section {
  position: relative;
  padding: 112px 0;
}

.top-section__inner {
  width: min(var(--content-width), calc(100% - (var(--page-gutter-pc) * 2)));
  margin: 0 auto;
}

.top-section__head {
  display: grid;
  grid-template-columns: minmax(0, 1fr) minmax(280px, 420px);
  align-items: end;
  gap: 64px;
  margin-bottom: 52px;
}

.top-section__en {
  margin-bottom: 12px;
  color: var(--color-accent);
  font-family: "Nunito", sans-serif;
  font-size: 12px;
  font-weight: 800;
  line-height: 1.4;
  letter-spacing: 0.18em;
}

.top-section__lead {
  font-size: 15px;
  line-height: 2;
}

/* Scroll reveal
--------------------------------------------------------- */
.js-scroll-reveal,
.js-motion-heading {
  opacity: 0;
}

.js-scroll-reveal {
  transition: opacity 0.75s ease;
}

.js-scroll-reveal.is-visible {
  opacity: 1;
}

.js-motion-heading.is-visible {
  opacity: 1;
}

/* Shared animated title
--------------------------------------------------------- */
.top-motion-heading {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  gap: 0.08em;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: clamp(36px, 3.7vw, 54px);

  line-height: 1.35;
  letter-spacing: 0.02em;
}

.top-motion-heading__normal {
  display: inline-block;
  transform: translateX(-52px);
  opacity: 0;
}

.top-motion-heading__normal em {
  color: var(--color-accent);
  font-style: normal;
}

.top-motion-heading__hand {
  display: inline-flex;
  align-items: center;
}

.top-motion-heading__hand i {
  display: grid;
  place-items: center;
  width: 1.34em;
  height: 1.34em;
  margin-left: -0.06em;
  border: 2px solid var(--color-text-main);
  border-radius: 50%;
  color: var(--color-accent);
  font-size: 0.78em;
  font-style: normal;
  line-height: 1;
}

.js-motion-heading.is-visible .top-motion-heading__normal {
  animation: topSlideIn 0.7s cubic-bezier(0.22, 1, 0.36, 1) forwards;
}

.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(1) {
  animation-delay: 0.58s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(2) {
  animation-delay: 0.72s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(3) {
  animation-delay: 0.86s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(4) {
  animation-delay: 1s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(5) {
  animation-delay: 1.14s;
}

@keyframes topSlideIn {
  from {
    opacity: 0;
    transform: translateX(-52px);
  }
  to {
    opacity: 1;
    transform: translateX(0);
  }
}

@keyframes topHandIn {
  from {
    opacity: 0;
    transform: translateX(-18px) scale(0.88);
  }
  to {
    opacity: 1;
    transform: translateX(0) scale(1);
  }
}

/* Hero
--------------------------------------------------------- */
.top-hero {
  box-sizing: border-box;
  height: 100svh;
  padding-top: 80px;
  background: var(--color-back-beige);
}

.top-hero__viewport {
  position: relative;
  width: min(100%, 2000px);
  height: 100%;
  min-height: 0;
  margin: 0 auto;
  overflow: hidden;
}

.top-hero__slides,
.top-hero__slide,
.top-hero__slide-inner {
  position: absolute;
  inset: 0;
}

.top-hero__slide {
  z-index: 0;
  visibility: hidden;
  opacity: 0;
  pointer-events: none;
  transition: opacity 1.5s ease;
}

.top-hero__slide.is-active {
  z-index: 1;
  visibility: visible;
  opacity: 1;
  pointer-events: auto;
}

/*
 * 1440pxデザイン時:
 * 右画像 783 x 736px / hero 783px高 を基準に可変。
 * 2000px未満では画面幅いっぱい、2000px以上でviewportのみ中央寄せ。
 */
.top-hero__slide-inner {
  display: block;
}

.top-hero__copy {
  position: absolute;
  top: 50%;
  left: 8.333%;
  z-index: 2;
  width: 44%;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: clamp(50px, min(5.65vw, 9.2svh), 90px);
  font-weight: 700;
  line-height: 1.16;
  letter-spacing: -0.025em;
  transform: translateY(-50%);
}

.top-hero__line {
  display: flex;
  align-items: center;
  width: max-content;
  max-width: 100%;
}

/* 3行すべてを同タイミングで左→右へ */
.top-hero__line--base {
  opacity: 0;
  transform: translateX(-80px);
}

.top-hero__line--base em {
  color: #df0011;
  font-style: normal;
}

.top-hero__line--keyword {
  margin: 0.05em 0;
}

.top-hero__after-hand {
  display: inline-block;
  margin-left: 0.08em;
}

.top-hero__hand {
  display: inline-flex;
  align-items: center;
}

/* 円はベースコピーと一緒に表示し、中の文字だけ遅れて出す */
.top-hero__hand i {
  display: grid;
  place-items: center;
  width: 1.18em;
  height: 1.18em;
  margin-left: -0.03em;
  border: 3px solid #241b18;
  border-radius: 50%;
  color: #df0011;
  font-size: 0.78em;
  font-style: normal;
  line-height: 1;
}

.top-hero__hand i > span {
  display: block;
  opacity: 0;
  transform: translateX(-12px) scale(0.9);
}

.top-hero__hand--latin i {
  font-family: "Nunito", sans-serif;
  font-size: 0.58em;
}

.top-hero__hand--long i {
  width: 1.06em;
  height: 1.06em;
}

.top-hero__slide.is-active .top-hero__line--base {
  animation: heroNormalIn 0.82s cubic-bezier(0.22, 1, 0.36, 1) 0.12s forwards;
}

.top-hero__slide.is-active .top-hero__hand i > span {
  animation: heroHandLetterIn 0.28s ease forwards;
}

.top-hero__slide.is-active .top-hero__hand i:nth-child(1) > span {
  animation-delay: 0.78s;
}
.top-hero__slide.is-active .top-hero__hand i:nth-child(2) > span {
  animation-delay: 0.92s;
}
.top-hero__slide.is-active .top-hero__hand i:nth-child(3) > span {
  animation-delay: 1.06s;
}
.top-hero__slide.is-active .top-hero__hand i:nth-child(4) > span {
  animation-delay: 1.2s;
}
.top-hero__slide.is-active .top-hero__hand i:nth-child(5) > span {
  animation-delay: 1.34s;
}

@keyframes heroNormalIn {
  from {
    opacity: 0;
    transform: translateX(-80px);
  }
  to {
    opacity: 1;
    transform: translateX(0);
  }
}

@keyframes heroHandLetterIn {
  from {
    opacity: 0;
    transform: translateX(-12px) scale(0.9);
  }
  to {
    opacity: 1;
    transform: translateX(0) scale(1);
  }
}

.top-hero__media {
  position: absolute;
  top: 50%;
  right: 2.292%;
  height: min(
    calc(min(100vw, 2000px) * 0.54375 * 736 / 783),
    calc(100% - 48px)
  );
  aspect-ratio: 783 / 736;
  width: auto;
  overflow: hidden;
  transform: translateY(-50%);
  border-radius: clamp(24px, 2.2vw, 42px);
  background: #f8dce1;
}

.top-hero__media picture {
  display: block;
  width: 100%;
  height: 100%;
}

.top-hero__media img {
  display: block;
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center;
  transform: scale(1.035);
  transition: transform 8s linear;
}

.top-hero__slide.is-active .top-hero__media img {
  transform: scale(1);
}

.top-hero__indicator {
  position: absolute;
  left: 2.778%;
  bottom: 31px;
  z-index: 4;
  display: flex;
  flex-direction: column;
  gap: 7px;
}

.top-hero__indicator button {
  position: relative;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background: #d9d9d9;
  transition: background 0.25s ease;
}

.top-hero__indicator button::after {
  position: absolute;
  inset: -6px;
  border-radius: 50%;
  content: "";
}

.top-hero__indicator button.is-active {
  background: var(--color-accent);
}

.top-hero__scroll {
  position: absolute;
  left: 50%;
  bottom: 35px;
  z-index: 4;
  display: flex;
  flex-direction: column;
  align-items: center;
  width: 52px;
  height: 32.41px;
  color: var(--color-accent);
  transform: translateX(-50%);
  animation: topHeroScrollFloat 1.8s ease-in-out infinite;
}

@keyframes topHeroScrollFloat {
  0%,
  100% {
    transform: translate(-50%, 0);
  }

  50% {
    transform: translate(-50%, 8px);
  }
}

.top-hero__scroll-label {
  width: 52px;
  height: 16px;
  font-family: "Nunito", sans-serif;
  font-size: 12px;
  font-weight: 700;
  line-height: 16px;
  letter-spacing: 0.08em;
  text-align: center;
  white-space: nowrap;
}

.top-hero__scroll-icon {
  display: block;
  width: 5px;
  height: auto;
  margin-top: 4px;
}

.top-hero__brand {
  position: absolute;
  left: 8.333%;
  bottom: 24px;
  z-index: 4;
  width: clamp(150px, 15.3vw, 235px);
}

.top-hero__brand img {
  display: block;
  width: 100%;
  height: auto;
}

/* About
--------------------------------------------------------- */
.top-about {
  background: var(--color-gray0);
}

.top-about__inner {
  display: flex;
  align-items: center;
  justify-content: center;
}

.top-about__copy {
  text-align: center;
}

.top-about .top-section__en {
  display: none;
}

.top-about .top-heading {
  display: none;
}

/* Business
--------------------------------------------------------- */
.top-business {
  padding: 100px 0;
  background: var(--color-back-beige);
}

.top-business__inner {
  width: min(1000px, calc(100% - (var(--page-gutter-pc) * 2)));
  margin: 0 auto;
}

.top-business__content {
  display: flex;
  flex-direction: column;
  align-items: flex-start;
  gap: 37px;
}

.top-business .top-motion-heading {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  gap: 0.08em;
  margin: 0;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 80px;
  font-weight: 900;
  line-height: 1.1;
  letter-spacing: 0;
}

.top-business__lead {
  margin: 0;
  font-size: 16px;
  font-weight: 700;
  line-height: 2;
}

.top-more {
  display: flex;
  flex-direction: row;
  align-items: center;
  justify-content: center;
  gap: 8px;
  width: 178px;
  height: 52px;
  padding: 0 28px;
  border-radius: 4px;
  background: #2a363c;
  color: #fff;
  font-family: "Noto Sans JP", sans-serif;
  font-size: 16px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: 0.1em;
  white-space: nowrap;
}

.top-more > span:first-child {
  flex: 0 0 auto;
  white-space: nowrap;
}

.top-more {
  transition: opacity 0.3s ease;
}

.top-more:hover,
.top-more:focus-visible {
  opacity: 0.8;
}

.top-more__arrow {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  flex: 0 0 24px;
  width: 24px;
  height: 24px;
  line-height: 1;
  letter-spacing: 0;
}

.top-business__loop {
  width: 100%;
  margin-top: 100px;
  overflow: hidden;
}

.top-business__track {
  display: flex;
  width: max-content;
  animation: businessLoop 34s linear infinite;
  will-change: transform;
}

.top-business__set {
  display: flex;
  gap: 16px;
  padding-right: 16px;
}

.top-business__media {
  width: 423px;
  aspect-ratio: 423 / 304;
  overflow: hidden;
  border-radius: 4px;
  background: #eee;
}

.top-business__media img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}

@keyframes businessLoop {
  to {
    transform: translateX(-50%);
  }
}

/* Interview
--------------------------------------------------------- */
.top-interview {
  padding: 100px 0;
  overflow: hidden;
  background: var(--color-back-pink);
}

.top-interview__inner {
  width: min(1000px, calc(100% - (var(--page-gutter-pc) * 2)));
  margin: 0 auto;
}

.top-interview__intro {
  display: flex;
  flex-direction: column;
  align-items: flex-end;
  gap: 37px;
  text-align: right;
}

.top-interview .top-motion-heading {
  justify-content: flex-end;
  margin: 0;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 80px;
  font-weight: 900;
  line-height: 1.1;
}

.top-interview__lead {
  margin: 0;
  font-size: 16px;
  font-weight: 700;
  line-height: 2;
}

.top-interview__people {
  margin-top: 64px;
}

.top-interview__group-title {
  margin: 0;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 32px;
  font-weight: 700;
  line-height: 1.3;
  letter-spacing: 0.05em;
  text-align: center;
}

.top-interview__grid {
  display: grid;
  grid-template-columns: repeat(4, 238px);
  gap: 32px 16px;
  margin-top: 24px;
}

.top-interview-card {
  display: flex;
  flex-direction: column;
  width: 238px;
  min-height: 315px;
  overflow: hidden;
  border-radius: 8px;
  background: #fff;
}

.top-interview-card__media {
  width: 100%;
  height: 180px;
  overflow: hidden;
  border-radius: 8px 8px 0 0;
}

.top-interview-card__media img,
.top-crosstalk-card__media img {
  width: 100%;
  height: 100%;
  object-fit: cover;
  transition: transform 0.3s ease;
}

.top-interview-card:hover .top-interview-card__media img,
.top-interview-card:focus-visible .top-interview-card__media img,
.top-crosstalk-card:hover .top-crosstalk-card__media img,
.top-crosstalk-card:focus-visible .top-crosstalk-card__media img {
  transform: scale(1.05);
}

.top-interview-card__body {
  display: flex;
  flex: 1;
  flex-direction: column;
  align-items: flex-start;
  padding: 12px 24px 16px;
}

.top-interview-card__tag {
  display: inline-flex;
  align-items: center;
  min-height: 27px;
  padding: 8px 16px;
  border-radius: 100px;
  color: #fff;
  font-size: 11px;
  font-weight: 500;
  line-height: 1;
}

.top-interview-card__tag--food {
  background: #bda684;
}

.top-interview-card__tag--production {
  background: #3f6f86;
}

.top-interview-card__tag--chemical {
  background: #47a386;
}

.top-interview-card__tag--common {
  background: #3860be;
}

.top-interview-card h3 {
  margin-top: 4px;
  font-size: 16px;
  font-weight: 500;
  line-height: 1.6;
  letter-spacing: 0.05em;
}

.top-interview-card__meta {
  display: flex;
  align-items: flex-end;
  gap: 8px;
  width: 100%;
  margin-top: auto;
}

.top-interview-card__meta p {
  flex: 1;
  margin: 0;
  color: var(--color-text-sub);
  font-size: 13px;
  font-weight: 400;
  line-height: 1.3;
  letter-spacing: 0.05em;
}

.top-interview-card__arrow,
.top-crosstalk-card__arrow {
  display: flex;
  flex: 0 0 24px;
  align-items: center;
  justify-content: center;
  width: 24px;
  height: 24px;
  color: var(--color-accent);
}

.top-interview__crosstalk {
  margin-top: 64px;
}

.top-crosstalk__grid {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 24px;
  margin-top: 24px;
}

.top-crosstalk-card {
  display: flex;
  flex-direction: column;
  min-height: 407px;
  overflow: hidden;
  border-radius: 8px;
  background: #fff;
}

.top-crosstalk-card__media {
  width: 100%;
  height: 260px;
  overflow: hidden;
  border-radius: 8px 8px 0 0;
}

.top-crosstalk-card__body {
  position: relative;
  display: flex;
  flex: 1;
  flex-direction: column;
  align-items: flex-start;
  min-height: 147px;
  padding: 0 24px 16px;
}

.top-crosstalk-card h4 {
  margin: 0;
  color: var(--color-text-main);
  font-size: 24px;
  font-weight: 700;
  line-height: 3;
  letter-spacing: 0.05em;
}

.top-crosstalk-card__title-accent {
  color: var(--color-accent);
}

.top-crosstalk-card p {
  margin: 0;
  padding-right: 32px;
  font-size: 14px;
  font-weight: 500;
  line-height: 1.6;
  letter-spacing: 0.05em;
}

.top-crosstalk-card__arrow {
  position: absolute;
  right: 24px;
  bottom: 16px;
}

/* Company
--------------------------------------------------------- */
.top-company {
  padding: 160px 0 100px;
  overflow: hidden;
  background: var(--color-back-beige);
}

.top-company__inner {
  width: min(1000px, calc(100% - (var(--page-gutter-pc) * 2)));
  margin: 0 auto;
}

.top-company__intro {
  display: flex;
  flex-direction: column;
  align-items: flex-start;
  gap: 64px;
  text-align: left;
}

.top-company .top-motion-heading {
  justify-content: flex-start;
  margin: 0;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 80px;
  font-weight: 900;
  line-height: 1.1;
}

.top-company__lead {
  margin: 0;
  font-size: 16px;
  font-weight: 700;
  line-height: 2;
}

.top-company__grid {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 24px;
  margin-top: 64px;
}

.top-company-card {
  display: flex;
  flex-direction: column;
  overflow: hidden;
  border-radius: 8px;
  background: #fff;
}

.top-company-card__media {
  width: 100%;
  height: 200px;
  overflow: hidden;
}

.top-company-card__media img {
  width: 100%;
  height: 100%;
  object-fit: cover;
  transition: transform 0.3s ease;
}

.top-company-card:hover .top-company-card__media img,
.top-company-card:focus-visible .top-company-card__media img {
  transform: scale(1.05);
}

.top-company-card__body {
  display: flex;
  flex-direction: column;
  gap: 24px;
  padding: 16px 16px 24px;
}

.top-company-card h3 {
  display: flex;
  align-items: center;
  justify-content: center;
  margin: 0;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 29px;
  font-weight: 900;
  line-height: 1.1;
  letter-spacing: -0.1em;
  text-align: center;
}

.top-company-card__circle-text {
  display: inline-flex;
  align-items: center;
  gap: 0;
  margin-right: 0.12em;
  color: #2b2b2b;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 39px;
  font-weight: 500;
  line-height: 1.1;
}

.top-company-card__circle-text i {
  position: relative;
  display: inline-flex;
  align-items: center;
  justify-content: center;

  font-style: normal;
}

.top-company-card__circle-text i::before {
  position: absolute;
  inset: 50% auto auto 50%;

  border: 2.5px solid #2b2b2b;
  border-radius: 50%;
  content: "";
  transform: translate(-50%, -50%);
}

.top-company-card__circle-text i span {
  position: relative;
  z-index: 1;
  color: #e70014;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 28px;

  line-height: 1;
  letter-spacing: 0;
}

.top-company-card__detail {
  display: flex;
  align-items: center;
  gap: 0;
}

.top-company-card__detail p {
  flex: 1;
  margin: 0;
  font-size: 14px;
  font-weight: 500;
  line-height: 1.6;
  letter-spacing: 0.05em;
}

.top-company-card__arrow {
  display: flex;
  flex: 0 0 24px;
  align-items: center;
  justify-content: center;
  width: 24px;
  height: 24px;
  color: var(--color-accent);
}

/* Information / download
--------------------------------------------------------- */
.top-information {
  background: var(--color-back-pink);
}

.top-information__title {
  margin-bottom: 40px;
  text-align: center;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: clamp(32px, 3vw, 44px);
  font-weight: 700;
  letter-spacing: 0.08em;
}

.top-information__grid {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 28px;
  width: min(920px, 100%);
  margin: 0 auto;
}

.top-information__item {
  text-align: center;
}

.top-information__thumb {
  box-sizing: border-box;
  aspect-ratio: 1.52 / 1;
  border: 1px solid #fff;
  border-radius: 8px;
  background-color: #efefef;
  background-position: center;
  background-repeat: no-repeat;
  background-size: contain;
}

.top-information__thumb--company {
  background-image: url("/recruit/assets/img/top/download_company.webp");
}

.top-information__thumb--recruit {
  background-image: url("/recruit/assets/img/top/download_recruit.webp");
}

.top-information__item h3 {
  margin-top: 14px;
  font-family: "Zen Maru Gothic", sans-serif;
  font-size: 22px;
  font-weight: 700;
}

.top-information__button {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  gap: 12px;
  width: min(310px, 100%);
  min-height: 58px;
  margin-top: 12px;
  border: 1px solid var(--color-accent);
  border-radius: 999px;
  background: #fff;
  color: var(--color-text-main);
  font-weight: 700;
  transition:
    background-color 0.25s ease,
    color 0.25s ease;
}

.top-information__download-icon {
  width: 18px;
  height: 18px;
  background: var(--color-accent);
  -webkit-mask: url("/recruit/assets/img/top/icon_download.svg") center /
    contain no-repeat;
  mask: url("/recruit/assets/img/top/icon_download.svg") center / contain
    no-repeat;
  transition: background 0.25s ease;
}

.top-information__button:hover,
.top-information__button:focus-visible {
  background: var(--color-accent);
  color: #fff;
}

.top-information__button:hover .top-information__download-icon,
.top-information__button:focus-visible .top-information__download-icon {
  background: #fff;
}

@media (max-width: 1399px) {
  .top-company__inner {
    width: min(1000px, calc(100% - (var(--page-gutter-tablet) * 2)));
  }

  .top-interview__inner {
    width: min(1000px, calc(100% - (var(--page-gutter-tablet) * 2)));
  }

  .top-interview__grid {
    grid-template-columns: repeat(4, minmax(0, 1fr));
  }

  .top-interview-card {
    width: 100%;
  }

  .top-business__inner {
    width: min(1000px, calc(100% - (var(--page-gutter-tablet) * 2)));
  }

  .top-section__inner {
    width: min(
      var(--content-width),
      calc(100% - (var(--page-gutter-tablet) * 2))
    );
  }

  .top-section__head {
    gap: 40px;
  }

  .top-hero__slide-inner {
    grid-template-columns: minmax(360px, 0.9fr) minmax(480px, 1.1fr);
    padding-inline: var(--page-gutter-tablet);
  }

  .top-hero__indicator {
    left: var(--page-gutter-tablet);
  }
}

@media (max-width: 1023px) {
  .top-hero {
    padding-top: 64px;
  }

  .top-hero__viewport {
    height: max(620px, calc(100svh - 64px));
  }

  .top-hero__slide-inner {
    grid-template-columns: 0.85fr 1.15fr;
    gap: 24px;
  }

  .top-hero__copy {
    font-size: clamp(38px, 5.4vw, 58px);
  }

  .top-hero__hand i {
    border-width: 2px;
  }
}

@media (max-width: 767px) {
  .top-company {
    padding: 100px 0 80px;
  }

  .top-company__inner {
    width: calc(100% - (var(--page-gutter-sp) * 2));
  }

  .top-company__intro {
    gap: 32px;
  }

  .top-company .top-motion-heading {
    font-size: clamp(42px, 12vw, 56px);
  }

  .top-company__lead {
    font-size: 14px;
    line-height: 2;
  }

  .top-company-card__detail br {
    display: none;
  }

  .top-company__grid {
    margin-top: 40px;
  }

  .top-company-card__media {
    height: auto;
    aspect-ratio: 488 / 200;
  }

  .top-company-card__body {
    gap: 18px;
  }

  .top-company-card__circle-text {
    font-size: 32px;
  }

  .top-company-card__circle-text i span {
    font-size: 23px;
  }

  .top-company-card__detail p {
    font-size: 12px;
  }

  .top-interview {
    padding: 80px 0;
  }

  .top-interview__inner {
    width: calc(100% - (var(--page-gutter-sp) * 2));
  }

  .top-interview__intro {
    gap: 28px;
  }

  .top-interview .top-motion-heading {
    font-size: clamp(42px, 12vw, 56px);
  }

  .top-interview__lead {
    font-size: 14px;
    line-height: 2;
  }

  .top-interview__lead br.top-pc-br:not(.top-sp-br) {
    display: none;
  }

  .top-interview__people,
  .top-interview__crosstalk {
    margin-top: 56px;
  }

  .top-interview__group-title {
    font-size: 26px;
  }

  .top-interview__grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 16px 12px;
  }

  .top-interview-card {
    width: 100%;
    min-height: 0;
  }

  .top-interview-card__media {
    height: auto;
    aspect-ratio: 238 / 180;
  }

  .top-interview-card__body {
    padding: 10px 12px 14px;
  }

  .top-interview-card__tag {
    min-height: 22px;
    padding: 6px 10px;
    font-size: 10px;
  }

  .top-interview-card h3 {
    font-size: 14px;
  }

  .top-interview-card__meta p {
    font-size: 11px;
  }

  .top-crosstalk__grid {
    grid-template-columns: 1fr;
    gap: 16px;
  }

  .top-crosstalk-card {
    min-height: 0;
  }

  .top-crosstalk-card__media {
    height: auto;
    aspect-ratio: 484 / 260;
  }

  .top-crosstalk-card__body {
    min-height: 0;
    padding: 0 16px 18px;
  }

  .top-crosstalk-card h4 {
    font-size: 20px;
    line-height: 2.5;
  }

  .top-crosstalk-card p {
    padding-right: 32px;
    font-size: 12px;
  }

  .top-crosstalk-card p br {
    display: none;
  }

  .top-crosstalk-card__arrow {
    right: 16px;
    bottom: 16px;
  }

  .top-business {
    padding: 80px 0;
  }

  .top-business__inner {
    width: calc(100% - (var(--page-gutter-sp) * 2));
  }

  .top-business__content {
    gap: 28px;
  }

  .top-business .top-motion-heading {
    font-size: clamp(42px, 12vw, 56px);
  }

  .top-business__lead {
    font-size: 14px;
    line-height: 2;
  }

  .top-business__lead br.top-pc-br:not(.top-sp-br) {
    display: none;
  }

  .top-business__loop {
    margin-top: 64px;
  }

  .top-business__media {
    width: min(78vw, 340px);
    aspect-ratio: 423 / 304;
  }

  .top-section {
    padding: 80px 0;
  }

  .top-section__inner {
    width: calc(100% - (var(--page-gutter-sp) * 2));
  }

  .top-section__head {
    display: block;
    margin-bottom: 34px;
  }

  .top-section__lead {
    margin-top: 18px;
    font-size: 14px;
    line-height: 1.9;
  }

  .top-motion-heading {
    font-size: clamp(29px, 8vw, 36px);
  }

  .top-hero {
    padding-top: 56px;
  }

  .top-hero__viewport {
    height: calc(100svh - 56px);
    min-height: 600px;
    max-height: 820px;
  }

  .top-hero__slide-inner {
    display: block;
    padding: 28px var(--page-gutter-sp) 54px;
  }

  .top-hero__copy {
    position: absolute;
    left: var(--page-gutter-sp);
    top: 46px;
    z-index: 3;
    font-size: clamp(34px, 10.2vw, 48px);
  }

  .top-hero__media {
    position: absolute;
    left: var(--page-gutter-sp);
    right: var(--page-gutter-sp);
    top: 34%;
    bottom: 58px;
    border-radius: 24px;
  }

  .top-hero__indicator {
    left: var(--page-gutter-sp);
    bottom: 22px;
    flex-direction: row;
    gap: 8px;
  }

  .top-hero__scroll {
    display: none;
  }

  .top-about__inner {
    min-height: 430px;
  }

  .top-about__lead {
    font-size: 15px;
    line-height: 2.15;
  }
  .top-company__grid {
    grid-template-columns: 1fr;
    gap: 16px;
  }

  .top-company-card__body {
    min-height: 124px;
    padding: 18px 48px 20px 18px;
  }

  .top-company-card h3 {
    font-size: 21px;
  }

  .top-company-card p {
    font-size: 12px;
  }

  .top-information__title {
    margin-bottom: 28px;
    font-size: 30px;
  }

  .top-information__grid {
    grid-template-columns: 1fr;
    gap: 36px;
  }

  .top-information__item h3 {
    font-size: 20px;
  }
}

@media (max-width: 1199px) {
  .top-hero__copy {
    left: var(--page-gutter-tablet);
    width: 42%;
    font-size: clamp(42px, 5.2vw, 64px);
  }

  .top-hero__media {
    right: var(--page-gutter-tablet);
    width: 53%;
  }

  .top-hero__brand {
    left: var(--page-gutter-tablet);
  }

  .top-hero__indicator {
    left: max(16px, calc(var(--page-gutter-tablet) / 2));
  }
}

@media (max-width: 767px) {
  .top-hero {
    padding-top: 64px;
  }

  .top-hero__viewport {
    height: calc(100svh - 64px);
    min-height: 640px;
  }

  .top-hero__copy {
    top: 9%;
    left: var(--page-gutter-sp);
    width: calc(100% - (var(--page-gutter-sp) * 2));
    font-size: clamp(35px, 10vw, 48px);
    transform: none;
  }

  .top-hero__media {
    top: auto;
    right: var(--page-gutter-sp);
    bottom: 72px;
    left: auto;
    width: calc(100% - (var(--page-gutter-sp) * 2));
    height: 54%;
    aspect-ratio: auto;
    border-radius: 22px;
    transform: none;
  }

  .top-hero__indicator {
    left: var(--page-gutter-sp);
    bottom: 26px;
    flex-direction: row;
  }

  .top-hero__scroll {
    right: var(--page-gutter-sp);
    bottom: 20px;
    left: auto;
    display: flex;
    transform: none;
  }

  .top-hero__brand {
    display: none;
  }
}
@media (prefers-reduced-motion: reduce) {
  .top-hero__slide,
  .top-hero__media img,
  .js-scroll-reveal,
  .top-person-card__media img,
  .top-company-card__media img,
  .top-information__button {
    transition: none;
  }

  .top-business__track {
    animation: none;
  }

  .top-hero__line--base,
  .top-hero__hand i,
  .top-hero__hand i > span,
  .top-motion-heading__normal,
  .top-motion-heading__hand i,
  .js-scroll-reveal,
  .js-motion-heading {
    opacity: 1;
    transform: none;
    animation: none !important;
  }
}

@media (min-width: 768px) {
  .top-hero__viewport {
    width: min(100%, 2000px);
    height: clamp(640px, 54.375vw, 1087.5px);
    min-height: 0;
    max-height: none;
  }

  .top-hero__copy {
    top: 49%;
    left: 5.556%;
    z-index: 3;
    width: 53%;
    max-width: none;
    font-size: clamp(86px, 8.2vw, 164px);
    line-height: 1.04;
    letter-spacing: -0.045em;
    transform: translateY(-50%);
  }

  .top-hero__line {
    max-width: none;
  }

  .top-hero__line--keyword {
    margin: 0.03em 0 0.015em;
  }

  .top-hero__hand i {
    width: 1.08em;
    height: 1.08em;
    border-width: 3px;
    font-size: 0.72em;
  }

  .top-hero__hand--latin i {
    font-size: 0.57em;
  }

  .top-hero__hand--long i {
    width: 0.98em;
    height: 0.98em;
  }

  .top-hero__media {
    top: 50%;
    right: 3.125%;
    width: 54.375%;
    height: 94%;
    aspect-ratio: auto;
    border-radius: clamp(28px, 2.25vw, 45px);
    transform: translateY(-50%);
  }

  .top-hero__brand {
    left: 5.556%;
    bottom: 4%;
    width: clamp(190px, 16.3vw, 326px);
  }

  .top-hero__indicator {
    left: 2.1%;
    bottom: 4%;
  }

  .top-hero__scroll {
    left: 54.5%;
    bottom: 2.8%;
  }
}

@media (min-width: 2000px) {
  .top-hero__copy {
    font-size: 164px;
  }
}

@media (min-width: 768px) {
  .top-hero {
    box-sizing: border-box;
    display: flex;
    align-items: center;
    justify-content: center;
    height: 100svh;
    min-height: 0;
    padding-top: 80px;
    overflow: hidden;
  }

  .top-hero__viewport {
    position: relative;
    container-type: inline-size;
    width: min(100%, calc((100svh - 80px) * 1440 / 783), 2000px);
    height: auto;
    min-height: 0;
    max-height: calc(100svh - 80px);
    aspect-ratio: 1440 / 783;
    margin: 0 auto;
    overflow: hidden;
    flex: 0 0 auto;
  }

  .top-hero__slides,
  .top-hero__slide,
  .top-hero__slide-inner {
    position: absolute;
    inset: 0;
  }

  .top-hero__copy {
    top: 49%;
    left: 5.556%;
    z-index: 3;
    width: 53%;
    max-width: none;
    font-size: 5.45cqw;
    line-height: 1.08;
    letter-spacing: -0.04em;
    transform: translateY(-50%);
  }

  .top-hero__line {
    max-width: none;
  }

  .top-hero__line--keyword {
    margin: 0.025em 0;
  }

  .top-hero__hand i {
    width: 1.12em;
    height: 1.12em;
    border-width: max(2px, 0.2cqw);
    font-size: 0.76em;
  }

  .top-hero__hand--latin i {
    font-size: 0.59em;
  }

  .top-hero__hand--long i {
    width: 1.01em;
    height: 1.01em;
  }

  .top-hero__media {
    top: 50%;
    right: 3.125%;
    width: 54.375%;
    height: 94%;
    aspect-ratio: auto;
    border-radius: 2.2cqw;
    transform: translateY(-50%);
  }

  .top-hero__brand {
    left: 5.556%;
    bottom: 4%;
    width: 16.3cqw;
  }

  .top-hero__indicator {
    left: 2.1%;
    bottom: 4%;
    gap: 0.48cqw;
  }

  .top-hero__indicator button {
    width: max(6px, 0.56cqw);
    height: max(6px, 0.56cqw);
  }
}

@media (min-width: 2000px) {
  .top-hero__viewport {
    width: min(2000px, calc((100svh - 80px) * 1440 / 783));
  }
}

@media (min-width: 768px) {
  .top-hero__copy {
    left: 5.556%;
    width: 58%;
    font-size: 8cqw;
    line-height: 1.04;
    letter-spacing: -0.045em;
  }

  .top-hero__line {
    width: max-content;
    max-width: none;
  }

  .top-hero__hand i {
    border-width: max(3px, 0.22cqw);
  }
}

/* Hero indicator: anchor to the hero/screen bottom-left, not the scaled stage. */
.top-hero {
  position: relative;
}

@media (min-width: 768px) {
  .top-hero > .top-hero__indicator {
    position: absolute;
    left: 32px;
    bottom: 32px;
    z-index: 6;
    display: flex;
    flex-direction: column;
    gap: 7px;
  }
}

/* About: Figma copy / typography / spacing. */
.top-about {
  padding-top: 100px;
  padding-bottom: 100px;
}

.top-about__inner {
  min-height: 0;
}

.top-about__copy {
  width: min(960px, 100%);
}

.top-about__lead {
  margin: 0;
  font-size: 20px;
  font-weight: 700;
  line-height: 3;
  text-align: center;
}

/* Shared motion heading:
   normal text + the empty circles slide in together;
   only the characters inside the circles appear afterward. */
.top-motion-heading__normal,
.top-motion-heading__hand {
  opacity: 0;
  transform: translateX(-52px);
}

.top-motion-heading__hand i {
  opacity: 1;
  transform: none;
}

.top-motion-heading__hand i > span {
  display: inline-block;
  opacity: 0;
  transform: translateX(-10px) scale(0.88);
}

.js-motion-heading.is-visible .top-motion-heading__normal,
.js-motion-heading.is-visible .top-motion-heading__hand {
  animation: topSlideIn 0.7s cubic-bezier(0.22, 1, 0.36, 1) forwards;
}

.js-motion-heading.is-visible .top-motion-heading__hand i {
  animation: none;
}

.js-motion-heading.is-visible .top-motion-heading__hand i > span {
  animation: topHandCharIn 0.28s ease forwards;
}

.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(1) > span {
  animation-delay: 0.58s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(2) > span {
  animation-delay: 0.72s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(3) > span {
  animation-delay: 0.86s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(4) > span {
  animation-delay: 1s;
}
.js-motion-heading.is-visible .top-motion-heading__hand i:nth-child(5) > span {
  animation-delay: 1.14s;
}

@keyframes topHandCharIn {
  from {
    opacity: 0;
    transform: translateX(-10px) scale(0.88);
  }
  to {
    opacity: 1;
    transform: translateX(0) scale(1);
  }
}

@media (max-width: 767px) {
  .top-hero > .top-hero__indicator {
    position: absolute;
    left: var(--page-gutter-sp);
    bottom: 22px;
    z-index: 6;
    display: flex;
    flex-direction: row;
    gap: 8px;
  }

  .top-about {
    padding-top: 80px;
    padding-bottom: 80px;
  }

  .top-about__lead {
    font-size: 15px;
    line-height: 2.15;
  }
}

@media (prefers-reduced-motion: reduce) {
  .top-motion-heading__normal,
  .top-motion-heading__hand,
  .top-motion-heading__hand i,
  .top-motion-heading__hand i > span {
    opacity: 1;
    transform: none;
    animation: none !important;
  }
}

/* Shared 18px arrow icon: color follows the surrounding link/button. */
.top-arrow-icon {
  display: block;
  width: 24px;
  height: 24px;
  flex: 0 0 24px;
}

.top-sp-br {
  display: none;
}

.top-pc-br {
  display: inline;
}

.top-interview__track,
.top-interview__page {
  display: contents;
}

.top-interview__pager {
  display: none;
}

@media (max-width: 767px) {
  .top-sp-br {
    display: inline;
  }

  .top-pc-br:not(.top-sp-br) {
    display: none;
  }

  /* About -------------------------------------------------- */
  .top-about {
    padding: 148px 24px 110px;
    background: linear-gradient(180deg, #ffffff 0%, #faf8f5 100%);
  }

  .top-about__inner {
    width: 100%;
    min-height: 580px;
  }

  .top-about__copy {
    width: 342px;
    max-width: 100%;
  }

  .top-about__lead {
    font-family: "Noto Sans JP", sans-serif;
    font-size: 15px;
    font-weight: 700;
    line-height: 2.8;
    letter-spacing: 0.1em;
  }

  /* Business ----------------------------------------------- */
  .top-business {
    padding: 140px 0 100px;
    background: rgba(189, 166, 132, 0.08);
  }

  .top-business__inner {
    width: 100%;
    padding: 0 24px;
  }

  .top-business__content {
    width: 342px;
    max-width: 100%;
    gap: 36px;
  }

  .top-business .top-motion-heading {
    width: 263px;
    max-width: 100%;
    font-size: 64px;
    line-height: 1.1;
  }

  .top-business__lead {
    font-size: 15px;
    line-height: 2;
    letter-spacing: 0.1em;
  }

  .top-business__lead br.top-pc-br:not(.top-sp-br) {
    display: none;
  }

  .top-more {
    width: 186px;
    height: 52px;
    padding: 0 36px;
  }

  .top-business__loop {
    margin-top: 32px;
  }

  .top-business__set {
    gap: 12px;
    padding-right: 12px;
  }

  .top-business__media {
    width: 167px;
    height: 120px;
    aspect-ratio: auto;
    border-radius: 2px;
  }

  /* Interview ---------------------------------------------- */
  .top-interview {
    padding: 140px 24px 100px;
  }

  .top-interview__inner {
    width: 342px;
    max-width: 100%;
  }

  .top-interview__intro {
    gap: 64px;
  }

  .top-interview .top-motion-heading {
    width: 336px;
    max-width: 100%;
    font-size: 48px;
    line-height: 1.1;
  }

  .top-interview .top-motion-heading__normal {
    white-space: nowrap;
  }

  .top-interview__lead {
    width: 100%;
    font-size: 15px;
    line-height: 2;
    letter-spacing: 0.1em;
  }

  .top-interview__lead br.top-pc-br:not(.top-sp-br) {
    display: none;
  }

  .top-interview__people {
    margin-top: 64px;
  }

  .top-interview__group-title {
    font-size: 24px;
    line-height: 1.3;
  }

  .top-interview__grid {
    display: block;
    margin-top: 24px;
    overflow: hidden;
    touch-action: pan-y;
  }

  .top-interview__track {
    display: flex;
    gap: 16px;
    width: 100%;
    transform: translate3d(0, 0, 0);
    transition: transform 0.35s ease;
    will-change: transform;
  }

  .top-interview__track.is-dragging {
    transition: none;
  }

  .top-interview__page {
    display: grid;
    flex: 0 0 100%;
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 24px 8px;
    width: 100%;
  }

  .top-interview-card {
    width: 100%;
    height: 289px;
    min-height: 289px;
    gap: 0;
  }

  .top-interview-card__media {
    height: 136px;
    aspect-ratio: auto;
  }

  .top-interview-card__body {
    position: relative;
    height: 153px;
    padding: 12px 8px 8px;
  }

  .top-interview-card__tag {
    min-height: 27px;
    padding: 8px 16px;
    font-size: 11px;
  }

  .top-interview-card h3 {
    margin-top: 8px;
    font-size: 14px;
    line-height: 1.6;
    letter-spacing: 0.05em;
  }

  .top-interview-card__meta {
    align-items: center;
    gap: 8px;
    margin-top: 8px;
  }

  .top-interview-card__arrow {
    position: absolute;
    right: 8px;
    bottom: 8px;
  }

  .top-interview-card__meta p {
    font-size: 12px;
    line-height: 1.5;
  }

  .top-interview__pager {
    display: flex;
    justify-content: center;
    gap: 8px;
    margin-top: 24px;
  }

  .top-interview__pager button {
    width: 6px;
    height: 6px;
    padding: 0;
    border: 0;
    border-radius: 999px;
    background: rgba(105, 105, 105, 0.3);
    cursor: pointer;
  }

  .top-interview__pager button.is-active {
    background: var(--color-accent);
  }

  .top-interview__crosstalk {
    margin-top: 64px;
  }

  .top-crosstalk__grid {
    gap: 24px;
    margin-top: 24px;
  }

  .top-crosstalk-card {
    min-height: 358px;
  }

  .top-crosstalk-card__media {
    height: 200px;
    aspect-ratio: auto;
  }

  .top-crosstalk-card__body {
    min-height: 158px;
    padding: 16px 16px 8px;
  }

  .top-crosstalk-card h4 {
    font-size: 20px;
    line-height: 1.6;
  }

  .top-crosstalk-card p {
    margin-top: 8px;
    padding-right: 0;
    font-size: 13px;
    line-height: 1.6;
  }

  .top-crosstalk-card p br {
    display: none;
  }

  .top-crosstalk-card__arrow {
    right: 16px;
    bottom: 8px;
  }

  /* Company ------------------------------------------------ */
  .top-company {
    padding: 160px 24px 100px;
    background: rgba(189, 166, 132, 0.08);
  }

  .top-company__inner {
    width: 342px;
    max-width: 100%;
  }

  .top-company__intro {
    gap: 36px;
  }

  .top-company .top-motion-heading {
    width: 263px;
    max-width: 100%;
    font-size: 64px;
    line-height: 1.1;
  }

  .top-company__lead {
    font-size: 15px;
    line-height: 2;
    letter-spacing: 0.1em;
  }

  .top-company__lead br.top-pc-br:not(.top-sp-br) {
    display: none;
  }

  .top-company__grid {
    gap: 24px;
    margin-top: 36px;
  }

  .top-company-card {
    min-height: 316px;
  }

  .top-company-card__media {
    height: 160px;
    aspect-ratio: auto;
  }

  .top-company-card__body {
    position: relative;
    min-height: 156px;
    gap: 12px;
    padding: 24px 16px 8px;
  }

  .top-company-card h3 {
    justify-content: flex-start;
    font-size: 26px;
    line-height: 1.1;
    text-align: left;
  }

  .top-company-card__circle-text {
    font-size: 35px;
  }

  .top-company-card__circle-text i span {
    font-size: 25px;
  }

  .top-company-card__detail {
    align-items: flex-start;
  }

  .top-company-card__arrow {
    position: absolute;
    right: 16px;
    bottom: 8px;
  }

  .top-company-card__detail p {
    font-size: 13px;
    line-height: 1.6;
  }

  .top-company-card__detail p br {
    display: none;
  }

  /* Information -------------------------------------------- */
  .top-information {
    padding: 80px 24px;
  }

  .top-information .top-section__inner {
    width: 342px;
    max-width: 100%;
  }

  .top-information__title {
    margin-bottom: 36px;
    font-size: 24px;
    line-height: 1.3;
    letter-spacing: 0.05em;
  }

  .top-information__grid {
    gap: 32px;
    width: 100%;
  }

  .top-information__item {
    text-align: left;
  }

  .top-information__thumb {
    width: 100%;
    height: 240px;
    aspect-ratio: auto;
    border-radius: 8px;
  }

  .top-information__item h3 {
    margin-top: 12px;
    font-size: 20px;
    line-height: 1.5;
    text-align: center;
  }

  .top-information__button {
    display: flex;
    width: 300px;
    max-width: 100%;
    min-height: 60px;
    margin: 12px auto 0;
    gap: 8px;
    font-size: 16px;
  }

  .top-information__download-icon {
    width: 20px;
    height: 20px;
  }
}

/* =========================================================
   Figma alignment: TOP PC 1440px / SP 390px
   Existing intermediate breakpoints and motion are preserved.
========================================================= */
@media (min-width: 1400px) {
  .top-business__loop {
    margin-top: 48px;
  }

  .top-information {
    padding: 80px 0;
  }

  .top-information .top-section__inner {
    width: 1000px;
  }

  .top-information__title {
    margin-bottom: 32px;
    font-size: 32px;
    line-height: 1.3;
    letter-spacing: 0.05em;
  }

  .top-information__grid {
    width: 1000px;
    gap: 24px;
  }

  .top-information__thumb {
    width: 488px;
    height: 320px;
    aspect-ratio: auto;
  }

  .top-information__item h3 {
    margin-top: 16px;
    font-size: 20px;
  }

  .top-information__button {
    width: 300px;
    min-height: 60px;
  }
}

@media (max-width: 767px) {
  .top-hero {
    height: auto;
    padding-top: 57px;
  }

  .top-hero__viewport {
    width: 100%;
    height: auto;
    min-height: 0;
    aspect-ratio: 390 / 321;
    overflow: visible;
  }

  .top-hero__slide,
  .top-hero__slide-inner {
    overflow: visible;
  }

  .top-hero__copy {
    top: 16px;
    left: 16px;
    display: flex;
    flex-wrap: wrap;
    align-items: center;
    width: calc(100% - 32px);
    font-size: clamp(32px, 9.74vw, 38px);
    line-height: 1.15;
    letter-spacing: -0.04em;
    transform: none;
  }

  .top-hero__line {
    width: auto;
  }

  .top-hero__line--keyword {
    margin: 0 0 0 0.08em;
  }

  .top-hero__copy > .top-hero__line:last-child {
    flex-basis: 100%;
  }

  .top-hero__hand i {
    border-width: 2px;
  }

  .top-hero__media {
    top: auto;
    right: 12px;
    bottom: 0;
    left: 12px;
    width: auto;
    height: 194px;
    aspect-ratio: auto;
    border-radius: 12px;
    transform: none;
  }

  .top-hero__brand {
    right: 22px;
    bottom: 198px;
    left: auto;
    display: block;
    width: 84px;
  }

  .top-hero > .top-hero__indicator {
    top: 216px;
    bottom: auto;
    left: 4px;
    flex-direction: column;
    gap: 6px;
  }

  .top-hero__indicator button {
    width: 6px;
    height: 6px;
  }

  .top-hero__scroll {
    top: calc(100% + 11px);
    bottom: auto;
  }

  .top-about {
    padding-top: 100px;
  }
}

@media (min-width: 768px) {
  .top-hero__hand i {
    border-width: 4px;
  }

  .top-motion-heading__hand i {
    border-width: 3px;
  }

  .top-company-card__circle-text i::before {
    border-width: 2px;
  }
}

@media (max-width: 767px) {
  .top-hero__hand i {
    border-width: 3px;
  }

  .top-motion-heading__hand i {
    border-width: 2.5px;
  }

  .top-company-card__circle-text i::before {
    border-width: 2px;
  }
}

@media (min-width: 768px) {
  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    width: 1.12em;
    height: 1.12em;
    flex: 0 0 1.12em;
    box-sizing: border-box;
    font-size: 0.76em;
  }

  .top-hero__hand--latin i > span {
    font-size: 0.776em;
  }
}

@media (max-width: 767px) {
  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    width: 1.12em;
    height: 1.12em;
    flex: 0 0 1.12em;
    box-sizing: border-box;
  }

  .top-hero__hand--latin i > span {
    font-size: 0.76em;
  }
}

@media (min-width: 768px) {
  .top-hero__copy {
    font-weight: 900;
  }

  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    border-width: 8px;
    font-weight: 900;
  }

  .top-hero__viewport > .top-hero__indicator {
    position: absolute;
    top: auto;
    right: auto;
    bottom: 4%;
    left: 2.1%;
    z-index: 6;
    display: flex;
    flex-direction: column;
    gap: 7px;
  }
}

@media (max-width: 767px) {
  .top-hero__viewport > .top-hero__indicator {
    position: absolute;
    top: 152px;
    right: auto;
    bottom: auto;
    left: 4px;
    z-index: 6;
    display: flex;
    flex-direction: column;
    gap: 6px;
  }
}

@media (max-width: 1199px) {
  .top-hero {
    height: auto;
    min-height: 0;
    padding-top: 57px;
    background: var(--color-back-beige);
  }

  .top-hero__viewport {
    position: relative;
    width: 100%;
    height: clamp(321px, 82.31vw, 630px);
    min-height: 0;
    margin: 0 auto;
    overflow: visible;
  }

  .top-hero__slides,
  .top-hero__slide,
  .top-hero__slide-inner {
    position: absolute;
    inset: 0;
  }

  .top-hero__slide,
  .top-hero__slide-inner {
    overflow: visible;
  }

  .top-hero__copy {
    position: absolute;

    left: clamp(16px, 4.1vw, 32px);
    z-index: 2;
    display: flex;

    align-items: center;
    width: calc(100% - clamp(32px, 8.2vw, 64px));

    font-weight: 900;

    letter-spacing: -0.04em;
    transform: none;
  }

  .top-hero__line {
    width: auto;
    max-width: 100%;
  }

  .top-hero__line--keyword {
    margin: 0 0 0 0.08em;
  }

  .top-hero__copy > .top-hero__line:last-child {
    flex-basis: 100%;
  }

  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    width: 1.12em;
    height: 1.12em;
    flex: 0 0 1.12em;
    box-sizing: border-box;

    font-size: 0.76em;
    font-weight: 900;
  }

  .top-hero__hand--latin i > span {
    font-size: 0.76em;
  }

  .top-hero__media {
    position: absolute;
    top: auto;
    right: clamp(12px, 3.08vw, 24px);
    bottom: 0;
    left: clamp(12px, 3.08vw, 24px);
    width: auto;
    height: clamp(194px, 49.74vw, 382px);
    aspect-ratio: auto;
    overflow: hidden;
    border-radius: clamp(12px, 3.08vw, 24px);
    transform: none;
  }

  .top-hero__media picture,
  .top-hero__media img {
    display: block;
    width: 100%;
    height: 100%;
  }

  .top-hero__media img {
    object-fit: cover;
    object-position: center;
  }

  .top-hero__brand {
    position: absolute;
    right: clamp(22px, 5.64vw, 44px);

    left: auto;
    z-index: 4;
    display: block;
    width: clamp(84px, 21.54vw, 150px);
  }

  .top-hero__viewport > .top-hero__indicator {
    position: absolute;

    right: auto;

    left: clamp(4px, 1.03vw, 8px);
    z-index: 6;
    display: flex;
    flex-direction: column;
    gap: 6px;
  }

  .top-hero__indicator button {
    width: 6px;
    height: 6px;
  }

  .top-hero__scroll {
    position: absolute;
    top: calc(100% + clamp(24px, 6.15vw, 48px));
    bottom: auto;
    left: 50%;
    z-index: 6;
    transform: translateX(-50%);
  }

  .top-about {
    padding-top: clamp(100px, 18vw, 150px);
  }

  .top-hero__viewport {
    --hero-sp-copy-top: clamp(16px, 4.1vw, 32px);
    --hero-sp-copy-size: clamp(44px, 11.28vw, 80px);
    --hero-sp-copy-block-height: clamp(101px, 25.9vw, 184px);
  }

  .top-hero__copy {
    top: var(--hero-sp-copy-top);
  }

  /* Desktop wording remains in the DOM; only the visible glyph is replaced below 1200px. */
  .top-hero__hand i > span[data-sp-char] {
    position: relative;
    display: grid;
    place-items: center;
    font-size: 1em;
    color: transparent;
  }

  .top-hero__hand i > span[data-sp-char]::after {
    position: absolute;
    inset: 0;
    display: grid;
    place-items: center;
    content: attr(data-sp-char);
  }

  .top-hero__hand--sp-latin i > span[data-sp-char] {
    font-family: "Nunito", sans-serif;
    font-size: 0.76em;
  }

  .top-hero__hand-char--sp-hidden {
    display: none !important;
  }

  .top-hero__viewport > .top-hero__indicator {
    top: auto;
    bottom: 0;
  }

  .top-hero__viewport {
    --hero-sp-copy-size: clamp(36px, 9.5vw, 76px);
    --hero-sp-copy-line-height: 1.15;
    --hero-sp-copy-block-height: calc(var(--hero-sp-copy-size) * 2.3);
  }

  .top-hero__copy {
    flex-wrap: wrap;
    align-content: flex-start;
    font-size: var(--hero-sp-copy-size);
    line-height: var(--hero-sp-copy-line-height);
    white-space: nowrap;
  }

  .top-hero__copy > .top-hero__line:first-child,
  .top-hero__copy > .top-hero__line--keyword {
    flex: 0 0 auto;
  }

  .top-hero__copy > .top-hero__line--keyword {
    margin-left: 0.08em;
  }

  .top-hero__copy > .top-hero__line:last-child {
    flex: 0 0 100%;
    width: max-content;
  }

  .top-hero__brand {
    top: calc(var(--hero-sp-copy-top) + var(--hero-sp-copy-block-height));
    bottom: auto;
    transform: translateY(-100%);
  }

  .top-hero__viewport {
    --hero-sp-copy-size: clamp(42px, 10.77vw, 82px);
    --hero-sp-copy-block-height: calc(var(--hero-sp-copy-size) * 2.3);
  }

  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    border-width: clamp(4px, 0.78vw, 6px);
  }

  .top-motion-heading__hand i {
    border-width: clamp(4px, 0.65vw, 5px);
  }

  .top-company-card__circle-text i::before {
    border-width: clamp(3px, 0.52vw, 4px);
  }

  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i,
  .top-motion-heading__hand i {
    border-width: clamp(4px, 0.78vw, 6px);
  }
}

.top-company-card__circle-text {
  letter-spacing: 0;
}

.top-company-card__circle-text i {
  flex: 0 0 1.06em;
  width: 1.06em;
  height: 1.06em;
  margin-left: -0.06em;
}

.top-company-card__circle-text i:first-child {
  margin-left: 0;
}

.top-company-card__circle-text i::before {
  width: 1em;
  height: 1em;
  border-width: 2px;
}

#interviewPeople,
#crosstalkArea,
#information-title {
  scroll-margin-top: 96px;
}

@media (max-width: 1199px) {
  #interviewPeople,
  #crosstalkArea,
  #information-title {
    scroll-margin-top: 72px;
  }
}

/* =========================================================
   Shared hover motion
========================================================= */
@media (hover: hover) and (pointer: fine) {
  .top-interview-card__arrow,
  .top-crosstalk-card__arrow,
  .top-company-card__arrow {
    transition: transform 0.3s ease;
  }

  .top-interview-card:hover .top-interview-card__arrow,
  .top-interview-card:focus-visible .top-interview-card__arrow,
  .top-crosstalk-card:hover .top-crosstalk-card__arrow,
  .top-crosstalk-card:focus-visible .top-crosstalk-card__arrow,
  .top-company-card:hover .top-company-card__arrow,
  .top-company-card:focus-visible .top-company-card__arrow {
    transform: translateX(5px);
  }
}

.top-motion-heading {
  font-weight: 900;
}

.top-motion-heading__hand i,
.top-motion-heading__hand i > span {
  font-family: "Zen Maru Gothic", sans-serif;
  font-weight: 900;
}

/* Motion-heading circles are smaller than the hero circles, so use a
   proportionally lighter stroke to keep the visual weight consistent. */
@media (min-width: 1200px) {
  .top-motion-heading__hand i {
    border-width: 6px;
  }
}

.top-company-card__circle-text i span {
  font-weight: 900;
}

@media (max-width: 1199px) {
  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    width: 1.22em;
    height: 1.22em;
    flex: 0 0 1.22em;
    border-width: clamp(3px, 0.65vw, 5px);
    font-size: 0.72em;
  }

  .top-hero__hand--latin i > span {
    font-size: 0.72em;
  }
}

@media (max-width: 767px) {
  .top-hero__hand i,
  .top-hero__hand--long i,
  .top-hero__hand--latin i {
    border-width: 3px;
  }
}

@media (max-width: 1199px) {
  .top-hero__copy .top-hero__line--keyword {
    margin-left: 0.02em;
  }

  .top-hero__copy .top-hero__hand i,
  .top-hero__copy .top-hero__hand--long i,
  .top-hero__copy .top-hero__hand--latin i {
    width: 1.3em;
    height: 1.3em;
    flex: 0 0 1.3em;
    margin-left: -0.1em;
    border-width: 3px;
    font-size: 0.72em;
  }
}

@media (max-width: 767px) {
  .top-hero__copy {
    font-size: clamp(38px, 9.95vw, 40px);
  }

  .top-hero__copy > .top-hero__line--keyword {
    margin-left: 0.08em;
  }

  .top-hero__copy .top-hero__hand i,
  .top-hero__copy .top-hero__hand--long i,
  .top-hero__copy .top-hero__hand--latin i {
    width: 1.3em;
    height: 1.3em;
    flex: 0 0 1.3em;
    margin-left: -0.05em;
    border-width: 3px;
    font-size: 0.82em;
  }

  .top-hero__copy .top-hero__hand i:first-child,
  .top-hero__copy .top-hero__hand--long i:first-child,
  .top-hero__copy .top-hero__hand--latin i:first-child {
    margin-left: 0;
  }

  .top-hero__copy .top-hero__hand i > span[data-sp-char] {
    font-size: 1em;
  }
}

.top-interview,
.top-company {
  position: relative;
  isolation: isolate;
  overflow: visible;
}

.top-interview__inner,
.top-company__inner {
  position: relative;
  z-index: 2;
}

.top-circle-decor {
  position: absolute;
  top: 0;
  left: 50%;
  z-index: 1;
  width: min(100%, 1440px);
  height: 100%;
  transform: translateX(-50%);
  pointer-events: none;
}

.top-circle-decor__circle {
  position: absolute;
  box-sizing: border-box;
  display: block;
  border-style: solid;
  border-width: 6px;
  border-radius: 50%;
}

/* ---------------------------------------------------------
   Interview / PC (Figma 1440 reference)
   --------------------------------------------------------- */
.top-circle-decor__circle--interview-brown-lg {
  top: 106px;
  left: -130px;
  width: 260px;
  height: 260px;
  border-color: #bda684;
}

.top-circle-decor__circle--interview-brown-sm {
  top: 54px;
  left: 79px;
  width: 71px;
  height: 71px;
  border-color: #bda684;
}

.top-circle-decor__circle--interview-red-lg {
  top: -42px;
  left: 1318px;
  width: 161px;
  height: 161px;
  border-color: #e3494b;
}

/* In Figma the small red circle sits below / left of the large one,
   rather than overlapping it at the upper edge. */
.top-circle-decor__circle--interview-red-sm {
  top: 67px;
  left: 1287px;
  width: 75px;
  height: 75px;
  border-color: #e3494b;
}

/* ---------------------------------------------------------
   Company / PC (Figma 1440 reference)
   --------------------------------------------------------- */
.top-circle-decor__circle--company-red-lg {
  top: -44px;
  left: -102px;
  width: 204px;
  height: 204px;
  border-color: #e3494b;
}

.top-circle-decor__circle--company-red-sm {
  top: 196px;
  left: 41px;
  width: 85px;
  height: 85px;
  border-color: #e3494b;
}

.top-circle-decor__circle--company-brown-lg {
  top: 66px;
  left: 1220px;
  width: 260px;
  height: 260px;
  border-color: #bda684;
}

/* ---------------------------------------------------------
   SP: Figma has a different circle composition from PC.
   Decorative circles stay below all headings / cards.
   --------------------------------------------------------- */
@media (max-width: 767px) {
  .top-circle-decor {
    z-index: 1;
    width: 100%;
  }

  .top-interview__inner,
  .top-company__inner {
    z-index: 2;
  }

  .top-circle-decor__circle {
    border-width: 3px;
  }

  /* Interview SP: one brown circle on the left and one red circle
     on the right. The PC-only small circles are not used. */
  .top-circle-decor__circle--interview-brown-lg {
    top: -8px;
    right: auto;
    left: -52px;
    width: 106px;
    height: 106px;
  }

  .top-circle-decor__circle--interview-red-lg {
    top: 118px;
    right: -50px;
    left: auto;
    width: 101px;
    height: 101px;
  }

  .top-circle-decor__circle--interview-brown-sm,
  .top-circle-decor__circle--interview-red-sm {
    display: none;
  }

  /* Company SP: red large + small on the left, brown large on the right.
     The group bleeds upward into the preceding pink section as in Figma. */
  .top-circle-decor__circle--company-red-lg {
    top: -52px;
    right: auto;
    left: -53px;
    width: 106px;
    height: 106px;
  }

  .top-circle-decor__circle--company-red-sm {
    top: 38px;
    right: auto;
    left: 42px;
    width: 34px;
    height: 34px;
  }

  .top-circle-decor__circle--company-brown-lg {
    top: 28px;
    right: -58px;
    left: auto;
    width: 116px;
    height: 116px;
  }
}

/* Business also needs to act as the positioning context for its decor. */
.top-business {
  position: relative;
  isolation: isolate;
  overflow: visible;
}

.top-business__inner,
.top-business__loop {
  position: relative;
  z-index: 2;
}

/* PC: the two red circles at the upper-right of Interview are separated,
   instead of visually touching/merging. */
@media (min-width: 768px) {
  .top-circle-decor__circle--interview-red-lg {
    top: -42px;
    left: 1332px;
    width: 161px;
    height: 161px;
  }

  .top-circle-decor__circle--interview-red-sm {
    top: 132px;
    left: 1278px;
    width: 75px;
    height: 75px;
  }

  /* Business decoration is SP-only. */
  .top-circle-decor--business {
    display: none;
  }
}

@media (max-width: 767px) {
  /* Business SP: red circle at the upper-right as shown in Figma. */
  .top-circle-decor--business {
    z-index: 1;
    width: 100%;
  }

  .top-circle-decor__circle--business-red-lg {
    top: 126px;
    right: -50px;
    left: auto;
    width: 102px;
    height: 102px;
    border-color: #e3494b;
  }

  /* Interview SP: Figma uses four circles, not the simplified two-circle
     composition. Keep all of them behind the content. */
  .top-circle-decor__circle--interview-brown-lg {
    display: block;
    top: -28px;
    left: -54px;
    width: 108px;
    height: 108px;
  }

  .top-circle-decor__circle--interview-brown-sm {
    display: block;
    top: -48px;
    left: 54px;
    width: 34px;
    height: 34px;
    border-color: #bda684;
  }

  .top-circle-decor__circle--interview-red-lg {
    display: block;
    top: 92px;
    right: -54px;
    left: auto;
    width: 108px;
    height: 108px;
  }

  .top-circle-decor__circle--interview-red-sm {
    display: block;
    top: 54px;
    right: -1px;
    left: auto;
    width: 34px;
    height: 34px;
    border-color: #e3494b;
  }
}

@media (min-width: 768px) {
  .top-circle-decor__circle--interview-red-sm {
    top: 116px;
    left: 1290px;
  }
}

@media (max-width: 767px) {
  /* Business SP / Figma: 129px circle, top 58px on the 390px stage. */
  .top-circle-decor__circle--business-red-lg {
    top: 58px;
    right: -63px;
    width: 129px;
    height: 128px;
  }

  /* Interview SP differs from PC: large brown left, red right,
     plus the small brown accent lower on the left. */
  .top-circle-decor__circle--interview-brown-lg {
    display: block;

    left: -61px;
    width: 139px;
    height: 138px;
  }

  .top-circle-decor__circle--interview-red-lg {
    display: block;

    right: -39px;
    left: auto;
    width: 99px;
    height: 99px;
  }

  .top-circle-decor__circle--interview-brown-sm {
    display: block;

    left: -7px;
    width: 45px;
    height: 45px;
    border-color: #bda684;
  }

  .top-circle-decor__circle--interview-red-sm {
    display: none;
  }

  /* Company SP / Figma proportions: 139px red, 45px red accent,
     and a 178px brown circle on the right. */
  .top-circle-decor__circle--company-red-lg {
    top: -69px;
    left: -70px;
    width: 139px;
    height: 138px;
  }

  .top-circle-decor__circle--company-red-sm {
    width: 45px;
    height: 45px;
  }

  .top-circle-decor__circle--company-brown-lg {
    top: -18px;
    right: -85px;
    left: auto;
    width: 178px;
    height: 178px;
  }

  /* Employee interview / SP: move the entire upper decoration higher
     while preserving the Figma-based relative composition. */
  .top-circle-decor__circle--interview-brown-lg {
    top: -48px;
  }

  .top-circle-decor__circle--interview-red-lg {
    top: 22px;
  }

  .top-circle-decor__circle--interview-brown-sm {
    top: 408px;
  }

  /* Company / SP: match Figma. The small red circle sits at the
     lower-right of the large circle with a slight overlap. */
  .top-circle-decor__circle--company-red-sm {
    top: 50px;
  }

  .top-circle-decor__circle--company-red-sm {
    left: 30px;
  }
}

/* =========================================================
   Tablet tuning : 768px - 1199px
   Keep PC (>=1200px) and SP (<=767px) unchanged.
========================================================= */
@media (min-width: 768px) and (max-width: 1199px) {
  /* Interview: secure a little more horizontal room and keep names on one line. */
  .top-interview-card__body {
    padding-right: 6px;
    padding-left: 6px;
  }

  .top-interview-card__meta p {
    font-size: 11px;
    white-space: nowrap;
  }

  /* Crosstalk: use the card width more efficiently to reduce line breaks. */
  .top-crosstalk-card__body {
    padding-right: 16px;
    padding-left: 16px;
  }

  .top-crosstalk-card p {
    width: 100%;
    padding-right: 0;
  }

  /* Company: tablet uses a compact decoration so it does not overlap the intro. */
  .top-circle-decor__circle--company-red-lg {
    top: -28px;
    left: -62px;
    width: 132px;
    height: 132px;
  }

  .top-circle-decor__circle--company-red-sm {
    top: 112px;
    left: 30px;
    width: 56px;
    height: 56px;
  }

  .top-circle-decor__circle--company-brown-lg {
    top: 54px;
    right: -72px;
    left: auto;
    width: 168px;
    height: 168px;
  }

  /* Company cards: switch the detail area to the SP-like stacked treatment. */

  .top-interview-card h3 {
    font-size: 14px;
  }

  .top-crosstalk-card p br {
    display: none;
  }

  /* Company card detail: use the same stacked treatment as SP. */
  .top-company-card__body {
    position: relative;
    gap: 18px;
    padding: 14px 14px 18px;
  }

  .top-company-card__detail p br {
    display: none;
  }

  .top-company-card__arrow {
    right: 14px;
    bottom: 14px;
  }

  /* Crosstalk: place the arrow on its own row below the text. */
  .top-crosstalk-card__body {
    display: flex;
    flex-direction: column;
  }

  .top-crosstalk-card__arrow {
    position: static;
    align-self: flex-end;
    margin-top: 8px;
  }

  /* Company: SP-like vertical detail layout, while keeping tablet text at 14px. */
  .top-company-card__detail {
    display: flex;
    flex-direction: column;
    align-items: stretch;
  }

  .top-company-card__detail p {
    width: 100%;
    padding-right: 0;
    font-size: 14px;
  }

  .top-company-card__arrow {
    position: static;
    align-self: flex-end;
    margin-top: 8px;
  }

  /* TOP hero / tablet: circled keyword stroke balance */
  .top-hero__copy .top-hero__hand i,
  .top-hero__copy .top-hero__hand--long i,
  .top-hero__copy .top-hero__hand--latin i {
    border-width: 5px;
  }

  /* TOP hero / tablet: add breathing room before circled keyword */
  .top-hero__copy .top-hero__hand i:first-child,
  .top-hero__copy .top-hero__hand--long i:first-child,
  .top-hero__copy .top-hero__hand--latin i:first-child {
    margin-left: 0.02em;
  }
}

.top-about {
  position: relative;
  overflow: hidden;
  isolation: isolate;
}

.top-about__metaball-svg {
  position: absolute;
  top: 0;
  left: 50%;
  z-index: 0;
  width: 100%;
  height: auto;
  bottom: 0;
  aspect-ratio: auto;
  transform: translateX(-50%);
  pointer-events: none;
}

@media (max-width: 767px) {
  .top-about__metaball-svg {
    top: 0;
    width: 100%;
    height: 100%;
    aspect-ratio: auto;
    transform: translateX(-50%);
  }
}

.top-about__metaball-group circle {
  fill: #000;
}

.top-about__inner {
  position: relative;
  z-index: 1;
}

@media (prefers-reduced-motion: reduce) {
  .top-about__metaball-svg {
    opacity: 0.9;
  }
}

@media (max-width: 767px) {
  .top-hero {
    padding-bottom: 17px;
  }

  .top-business {
    padding: 50px 0 100px;
  }
}

/* No.5 Tablet metaball area: .top-about 全体を描画領域にする */
@media (min-width: 768px) and (max-width: 1199px) {
  .top-hero {
    padding-bottom: 17px;
  }

  .top-about__metaball-svg {
    top: 0;
    width: 100%;
    height: 100%;
    aspect-ratio: auto;
    transform: translateX(-50%);
  }
}

/* =========================================================
   Safari / WebKit metaball performance guard
   - JS adds .is-safari only on genuine Safari.
   - Keep paint invalidation inside the About section.
========================================================= */
.is-safari .top-about {
  contain: paint;
}

.is-safari .top-about__metaball-svg {
  overflow: hidden;
}

.is-safari .top-about__metaball-plain-group {
  pointer-events: none;
}

/* =========================================================
   Handwriting SVG characters
   Illustrator outline exports: /assets/img/handwriting/top/
========================================================= */
.top-hero__hand i > span,
.top-motion-heading__hand i > span {
  display: grid;
  place-items: center;
  width: 100%;
  height: 100%;
}
.top-hero__hand .handwriting-char__img,
.top-motion-heading__hand .handwriting-char__img {
  display: block;
  width: 84%;
  height: 84%;
  object-fit: contain;
}
.top-hero__hand--latin .handwriting-char__img {
  width: 68%;
  height: 68%;
}

/* =========================================================
   TOP company cards / handwriting SVG + existing circles
   Keep the original black circular frame; replace only the red glyph.
========================================================= */
.top-company-card__circle-text--svg i {
  position: relative;
  display: inline-flex;
  align-items: center;
  justify-content: center;

  font-style: normal;
}

.top-company-card__circle-text--svg i::before {
  position: absolute;
  inset: 50% auto auto 50%;

  border-radius: 50%;
  content: "";
  transform: translate(-50%, -50%);
}

.top-company-card__circle-text--svg .top-company-card__handwriting-char {
  position: relative;
  z-index: 1;
  display: block;
  width: 72%;
  height: 72%;
  max-width: none;
  object-fit: contain;
}

/* 「採用担当を知る」：「用」のみ微調整 */
.top-company-card:nth-child(4)
  .top-company-card__circle-text--svg
  i:nth-child(2)
  .top-company-card__handwriting-char {
  width: 64%;
  height: 64%;
  top: 1px;
}

.top-company-card__circle-text--svg i {
  width: 0.88em;
  height: 1em;
  flex: 0 0 0.88em;
  margin-left: 0;
}
.top-company-card__circle-text--svg i:first-child {
  margin-left: 0;
}
.top-company-card__circle-text--svg i::before {
  width: 0.88em;
  height: 0.88em;
  border: 2.5px solid #2b2b2b;
  box-sizing: border-box;
}

.top-hero__hand .handwriting-char__img,
.top-hero__hand--latin .handwriting-char__img {
  max-width: none;
  object-fit: contain;
  transform: none;
}

.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  width: 67.15%;
  height: 51.93%;
}

.top-hero__slide:nth-child(3)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  width: 59.33%;
  height: 81.6%;
}

.top-hero__hand .handwriting-char__img,
.top-hero__hand--latin .handwriting-char__img {
  position: relative;
}

/* 01: ふっくら */

.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.018em;
  top: 0.123em;
}
.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: -0.053em;
  top: 0.018em;
}
.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.035em;
  top: 0.018em;
}

/* 02: サクサク */
.top-hero__slide:nth-child(2)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: -0.035em;
  top: 0.035em;
}

/* 03: しっとり */
.top-hero__slide:nth-child(3)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0;
  top: 0.035em;
}

/* 04: あわだち */

/* 05: ふわもち */

/* 06: うるおい */

/* 07: SDGs */

/* 08: のうこう */

/* slide 1: ふっくら */
.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.01em;
  top: -0.018em;
  width: 85.6%;
  height: 84.29%;
}
.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  width: 46.74%;
  height: 92%;
}
.top-hero__slide:nth-child(1)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  width: 55.46%;
  height: 86.59%;
}

/* slide 2: ザクザク */
.top-hero__slide:nth-child(2)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  width: 81.33%;
  height: 91.79%;
}
.top-hero__slide:nth-child(2)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.015em;
  top: 0.05em;
  width: 73.79%;
  height: 85.46%;
}
.top-hero__slide:nth-child(2)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: -0.035em;
  top: 0.035em;
  width: 81.33%;
  height: 91.79%;
}
.top-hero__slide:nth-child(2)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.015em;
  top: 0.05em;
  width: 73.79%;
  height: 85.46%;
}

/* slide 3: しっとり */
.top-hero__slide:nth-child(3)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.018em;
  top: 0.123em;
  width: 67.15%;
  height: 51.93%;
}
.top-hero__slide:nth-child(3)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: 0;
  top: 0.018em;
  width: 55.9%;
  height: 83.78%;
}
.top-hero__slide:nth-child(3)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.018em;
  top: 0.053em;
  width: 53.44%;
  height: 83.18%;
}

/* slide 4: あわだち */
.top-hero__slide:nth-child(4)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.005em;
  top: 0.035em;
  width: 64.88%;
  height: 81.9%;
}
.top-hero__slide:nth-child(4)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.018em;
  top: 0.035em;
  width: 70.62%;
  height: 77.54%;
}
.top-hero__slide:nth-child(4)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: 0;
  top: 0.005em;
  width: 74.7%;
  height: 77.99%;
}
.top-hero__slide:nth-child(4)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0;
  top: 0.015em;
  width: 61.41%;
  height: 81.36%;
}

/* slide 5: ふわもち */
.top-hero__slide:nth-child(5)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.023em;
  top: 0;
  width: 79.54%;
  height: 83.29%;
}
.top-hero__slide:nth-child(5)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.018em;
  top: 0.008em;
  width: 70.93%;
  height: 84.28%;
}
.top-hero__slide:nth-child(5)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: 0.003em;
  top: 0;
  width: 62.56%;
  height: 87.93%;
}
.top-hero__slide:nth-child(5)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.005em;
  top: 0;
  width: 62.75%;
  height: 88.43%;
}

/* slide 6: うるおい */
.top-hero__slide:nth-child(6)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.005em;
  top: 0.035em;
  width: 52.22%;
  height: 84.69%;
}
.top-hero__slide:nth-child(6)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.008em;
  top: 0.035em;
  width: 63.7%;
  height: 77.07%;
}
.top-hero__slide:nth-child(6)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: 0.008em;
  top: 0;
  width: 72.4%;
  height: 76.79%;
}
.top-hero__slide:nth-child(6)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.008em;
  top: 0.035em;
  width: 73.4%;
  height: 64.61%;
}

/* slide 7: SDGs */
.top-hero__slide:nth-child(7)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.005em;
  top: 0.023em;
  width: 56.04%;
  height: 72.34%;
}
.top-hero__slide:nth-child(7)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.048em;
  top: 0.035em;
  width: 59.23%;
  height: 67.98%;
}
.top-hero__slide:nth-child(7)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: 0.013em;
  top: 0.023em;
  width: 65.06%;
  height: 72.34%;
}
.top-hero__slide:nth-child(7)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: -0.123em;
  top: 0.158em;
  width: 40.12%;
  height: 52.85%;
}

/* slide 8: のうこう */
.top-hero__slide:nth-child(8)
  .top-hero__hand
  i:nth-child(1)
  .handwriting-char__img {
  left: 0.008em;
  top: 0.02em;
  width: 74.89%;
  height: 70.64%;
}
.top-hero__slide:nth-child(8)
  .top-hero__hand
  i:nth-child(2)
  .handwriting-char__img {
  left: 0.005em;
  top: 0.035em;
  width: 52.63%;
  height: 83.79%;
}
.top-hero__slide:nth-child(8)
  .top-hero__hand
  i:nth-child(3)
  .handwriting-char__img {
  left: -0.008em;
  top: 0.023em;
  width: 60.52%;
  height: 67.23%;
}
.top-hero__slide:nth-child(8)
  .top-hero__hand
  i:nth-child(4)
  .handwriting-char__img {
  left: 0.005em;
  top: 0.035em;
  width: 52.63%;
  height: 83.79%;
}